C30H40F2N4O2 — CID 145432116
1-(3,3-difluoroazetidin-1-yl)-2-[4-[2-[(2E,4E)-6-imino-5-methoxyocta-2,4-dien-3-yl]-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethanone (PubChem CID 145432116) has the molecular formula C30H40F2N4O2 and a molecular weight of 526.67 g/mol. Its IUPAC name is 1-(3,3-difluoroazetidin-1-yl)-2-[4-[2-[(2E,4E)-6-imino-5-methoxyocta-2,4-dien-3-yl]-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethanone.
| Compound Name | 1-(3,3-difluoroazetidin-1-yl)-2-[4-[2-[(2E,4E)-6-imino-5-methoxyocta-2,4-dien-3-yl]-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 145432116 |
| Molecular Formula | C30H40F2N4O2 |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | 1-(3,3-difluoroazetidin-1-yl)-2-[4-[2-[(2E,4E)-6-imino-5-methoxyocta-2,4-dien-3-yl]-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethanone |
| SMILES | [H]/N=C(CC)/C(=C\C(=C/C)c1[nH]c2ccc(C3CCN(CC(=O)N4CC(F)(F)C4)CC3)cc2c1C(C)C)OC |
| InChI | InChI=1S/C30H40F2N4O2/c1-6-20(15-26(38-5)24(33)7-2)29-28(19(3)4)23-14-22(8-9-25(23)34-29)21-10-12-35(13-11-21)16-27(37)36-17-30(31,32)18-36/h6,8-9,14-15,19,21,33-34H,7,10-13,16-18H2,1-5H3/b20-6+,26-15+,33-24+ |
| InChIKey | AFUAUXCGXYUUMV-JKDNURCLSA-N |
| XLogP | 6.31 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|