C41H62N2 — CID 134343705
2-[4-[3-[(3E,5E,6E)-5-but-3-en-2-ylidene-7-cyclopropyl-2,8-dimethyl-4-propyldeca-3,6-dien-3-yl]-4-methylphenyl]piperidin-1-yl]-1-cyclobutylidene-N-methylethanamine (PubChem CID 134343705) has the molecular formula C41H62N2 and a molecular weight of 582.96 g/mol. Its IUPAC name is 2-[4-[3-[(3E,5E,6E)-5-but-3-en-2-ylidene-7-cyclopropyl-2,8-dimethyl-4-propyldeca-3,6-dien-3-yl]-4-methylphenyl]piperidin-1-yl]-1-cyclobutylidene-N-methylethanamine.
| Compound Name | 2-[4-[3-[(3E,5E,6E)-5-but-3-en-2-ylidene-7-cyclopropyl-2,8-dimethyl-4-propyldeca-3,6-dien-3-yl]-4-methylphenyl]piperidin-1-yl]-1-cyclobutylidene-N-methylethanamine |
|---|---|
| PubChem CID | 134343705 |
| Molecular Formula | C41H62N2 |
| Molecular Weight | 582.96 g/mol |
| Exact Mass | 582.49 |
| IUPAC Name | 2-[4-[3-[(3E,5E,6E)-5-but-3-en-2-ylidene-7-cyclopropyl-2,8-dimethyl-4-propyldeca-3,6-dien-3-yl]-4-methylphenyl]piperidin-1-yl]-1-cyclobutylidene-N-methylethanamine |
| SMILES | C=C/C(C)=C(\C=C(/C(C)CC)C1CC1)C(/CCC)=C(/c1cc(C2CCN(CC(NC)=C3CCC3)CC2)ccc1C)C(C)C |
| InChI | InChI=1S/C41H62N2/c1-10-14-36(38(30(7)12-3)26-37(29(6)11-2)33-19-20-33)41(28(4)5)39-25-35(18-17-31(39)8)32-21-23-43(24-22-32)27-40(42-9)34-15-13-16-34/h12,17-18,25-26,28-29,32-33,42H,3,10-11,13-16,19-24,27H2,1-2,4-9H3/b37-26+,38-30+,41-36+ |
| InChIKey | FMGOJYIJGXMQQG-OWUASLCISA-N |
| XLogP | 10.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.96 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|