C36H56N2O — CID 142302499
2-(methylamino)-1-[4-[4-methyl-3-[(3E,5E,6Z)-2,7,8-trimethyl-5-(3-methylbut-3-en-2-ylidene)-4-propyldeca-3,6-dien-3-yl]phenyl]piperidin-1-yl]ethanone (PubChem CID 142302499) has the molecular formula C36H56N2O and a molecular weight of 532.86 g/mol. Its IUPAC name is 2-(methylamino)-1-[4-[4-methyl-3-[(3E,5E,6Z)-2,7,8-trimethyl-5-(3-methylbut-3-en-2-ylidene)-4-propyldeca-3,6-dien-3-yl]phenyl]piperidin-1-yl]ethanone.
| Compound Name | 2-(methylamino)-1-[4-[4-methyl-3-[(3E,5E,6Z)-2,7,8-trimethyl-5-(3-methylbut-3-en-2-ylidene)-4-propyldeca-3,6-dien-3-yl]phenyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 142302499 |
| Molecular Formula | C36H56N2O |
| Molecular Weight | 532.86 g/mol |
| Exact Mass | 532.44 |
| IUPAC Name | 2-(methylamino)-1-[4-[4-methyl-3-[(3E,5E,6Z)-2,7,8-trimethyl-5-(3-methylbut-3-en-2-ylidene)-4-propyldeca-3,6-dien-3-yl]phenyl]piperidin-1-yl]ethanone |
| SMILES | C=C(C)/C(C)=C(\C=C(\C)C(C)CC)C(/CCC)=C(/c1cc(C2CCN(C(=O)CNC)CC2)ccc1C)C(C)C |
| InChI | InChI=1S/C36H56N2O/c1-12-14-32(34(29(10)24(3)4)21-28(9)26(7)13-2)36(25(5)6)33-22-31(16-15-27(33)8)30-17-19-38(20-18-30)35(39)23-37-11/h15-16,21-22,25-26,30,37H,3,12-14,17-20,23H2,1-2,4-11H3/b28-21-,34-29+,36-32+ |
| InChIKey | QLTTZIBCPMSHRP-KKMUCIHCSA-N |
| XLogP | 9.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.86 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|