C9H15ClF2 — CID 134343911
(1S)-1-chloro-3-(1,2-difluoropropyl)cyclohexane (PubChem CID 134343911) has the molecular formula C9H15ClF2 and a molecular weight of 196.67 g/mol. Its IUPAC name is (1S)-1-chloro-3-(1,2-difluoropropyl)cyclohexane.
| Compound Name | (1S)-1-chloro-3-(1,2-difluoropropyl)cyclohexane |
|---|---|
| PubChem CID | 134343911 |
| Molecular Formula | C9H15ClF2 |
| Molecular Weight | 196.67 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | (1S)-1-chloro-3-(1,2-difluoropropyl)cyclohexane |
| SMILES | CC(F)C(F)C1CCC[C@H](Cl)C1 |
| InChI | InChI=1S/C9H15ClF2/c1-6(11)9(12)7-3-2-4-8(10)5-7/h6-9H,2-5H2,1H3/t6?,7?,8-,9?/m0/s1 |
| InChIKey | MNUWJMHVTKLTCQ-HZMRZXPBSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.67 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|