C17H16N4O3 — CID 134346317
5-[2-[(1-ethynylpyrazol-4-yl)methylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one (PubChem CID 134346317) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 5-[2-[(1-ethynylpyrazol-4-yl)methylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one.
| Compound Name | 5-[2-[(1-ethynylpyrazol-4-yl)methylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 134346317 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 5-[2-[(1-ethynylpyrazol-4-yl)methylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one |
| SMILES | C#Cn1cc(CNCC(O)c2ccc(O)c3[nH]c(=O)ccc23)cn1 |
| InChI | InChI=1S/C17H16N4O3/c1-2-21-10-11(8-19-21)7-18-9-15(23)12-3-5-14(22)17-13(12)4-6-16(24)20-17/h1,3-6,8,10,15,18,22-23H,7,9H2,(H,20,24) |
| InChIKey | HUFSKMBVNCXRPR-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|