About 3-[ethyl(dimethyl)azaniumyl]butane-1-sulfonate;3-methyloxet-2-one
3-[ethyl(dimethyl)azaniumyl]butane-1-sulfonate;3-methyloxet-2-one (PubChem CID 134346457) has the molecular formula C12H23NO5S
and a molecular weight of 293.38 g/mol. Its IUPAC name is 3-[ethyl(dimethyl)azaniumyl]butane-1-sulfonate;3-methyloxet-2-one.
Molecular Properties
| Compound Name | 3-[ethyl(dimethyl)azaniumyl]butane-1-sulfonate;3-methyloxet-2-one |
| PubChem CID | 134346457 |
| Molecular Formula | C12H23NO5S |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 3-[ethyl(dimethyl)azaniumyl]butane-1-sulfonate;3-methyloxet-2-one |
| SMILES | CC1=COC1=O.CC[N+](C)(C)C(C)CCS(=O)(=O)[O-] |
| InChI | InChI=1S/C8H19NO3S.C4H4O2/c1-5-9(3,4)8(2)6-7-13(10,11)12;1-3-2-6-4(3)5/h8H,5-7H2,1-4H3;2H,1H3 |
| InChIKey | ZKHLGYHVZWYOBP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[ethyl(dimethyl)azaniumyl]butane-1-sulfonate;3-methyloxet-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[ethyl(dimethyl)azaniumyl]butane-1-sulfonate;3-methyloxet-2-one?
The IUPAC name of 3-[ethyl(dimethyl)azaniumyl]butane-1-sulfonate;3-methyloxet-2-one (CID 134346457) is 3-[ethyl(dimethyl)azaniumyl]butane-1-sulfonate;3-methyloxet-2-one.
What is the SMILES notation for 3-[ethyl(dimethyl)azaniumyl]butane-1-sulfonate;3-methyloxet-2-one?
The canonical SMILES for 3-[ethyl(dimethyl)azaniumyl]butane-1-sulfonate;3-methyloxet-2-one is CC1=COC1=O.CC[N+](C)(C)C(C)CCS(=O)(=O)[O-].
What is the InChIKey of 3-[ethyl(dimethyl)azaniumyl]butane-1-sulfonate;3-methyloxet-2-one?
The InChIKey is ZKHLGYHVZWYOBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO3S.C4H4O2/c1-5-9(3,4)8(2)6-7-13(10,11)12;1-3-2-6-4(3)5/h8H,5-7H2,1-4H3;2H,1H3.
What are the key properties of 3-[ethyl(dimethyl)azaniumyl]butane-1-sulfonate;3-methyloxet-2-one?
3-[ethyl(dimethyl)azaniumyl]butane-1-sulfonate;3-methyloxet-2-one has a molecular weight of 293.38 g/mol, XLogP of 0.85, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[ethyl(dimethyl)azaniumyl]butane-1-sulfonate;3-methyloxet-2-one is sourced from PubChem (CID 134346457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).