C12H10F3N3O2 — CID 134350698
4-(1,2,4-oxadiazol-5-yl)-N-(3,3,3-trifluoropropyl)benzamide (PubChem CID 134350698) has the molecular formula C12H10F3N3O2 and a molecular weight of 285.22 g/mol. Its IUPAC name is 4-(1,2,4-oxadiazol-5-yl)-N-(3,3,3-trifluoropropyl)benzamide.
| Compound Name | 4-(1,2,4-oxadiazol-5-yl)-N-(3,3,3-trifluoropropyl)benzamide |
|---|---|
| PubChem CID | 134350698 |
| Molecular Formula | C12H10F3N3O2 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 4-(1,2,4-oxadiazol-5-yl)-N-(3,3,3-trifluoropropyl)benzamide |
| SMILES | O=C(NCCC(F)(F)F)c1ccc(-c2ncno2)cc1 |
| InChI | InChI=1S/C12H10F3N3O2/c13-12(14,15)5-6-16-10(19)8-1-3-9(4-2-8)11-17-7-18-20-11/h1-4,7H,5-6H2,(H,16,19) |
| InChIKey | KSXLYUBZDVQFKO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |