C31H37N3O3 — CID 134352218
8-hydroxy-N-[6-[(4-methoxy-2,6-dimethylphenyl)methyl]-1,2,3,4-tetrahydroquinolin-4-yl]-6-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine-4-carboxamide (PubChem CID 134352218) has the molecular formula C31H37N3O3 and a molecular weight of 499.66 g/mol. Its IUPAC name is 8-hydroxy-N-[6-[(4-methoxy-2,6-dimethylphenyl)methyl]-1,2,3,4-tetrahydroquinolin-4-yl]-6-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine-4-carboxamide.
| Compound Name | 8-hydroxy-N-[6-[(4-methoxy-2,6-dimethylphenyl)methyl]-1,2,3,4-tetrahydroquinolin-4-yl]-6-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 134352218 |
| Molecular Formula | C31H37N3O3 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | 8-hydroxy-N-[6-[(4-methoxy-2,6-dimethylphenyl)methyl]-1,2,3,4-tetrahydroquinolin-4-yl]-6-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine-4-carboxamide |
| SMILES | COc1cc(C)c(Cc2ccc3c(c2)C(NC(=O)C2Cc4c(C)cc(O)cc4CCN2)CCN3)c(C)c1 |
| InChI | InChI=1S/C31H37N3O3/c1-18-11-23(35)16-22-7-9-33-30(17-26(18)22)31(36)34-29-8-10-32-28-6-5-21(15-27(28)29)14-25-19(2)12-24(37-4)13-20(25)3/h5-6,11-13,15-16,29-30,32-33,35H,7-10,14,17H2,1-4H3,(H,34,36) |
| InChIKey | DYHIEBGYYHIANF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |