C30H33N3O3 — CID 142306746
6-hydroxy-N-[6-[(4-methoxy-2,3-dihydro-1H-inden-2-yl)methyl]-1,2,3,4-tetrahydroquinolin-4-yl]-4-methyl-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 142306746) has the molecular formula C30H33N3O3 and a molecular weight of 483.61 g/mol. Its IUPAC name is 6-hydroxy-N-[6-[(4-methoxy-2,3-dihydro-1H-inden-2-yl)methyl]-1,2,3,4-tetrahydroquinolin-4-yl]-4-methyl-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | 6-hydroxy-N-[6-[(4-methoxy-2,3-dihydro-1H-inden-2-yl)methyl]-1,2,3,4-tetrahydroquinolin-4-yl]-4-methyl-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 142306746 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 6-hydroxy-N-[6-[(4-methoxy-2,3-dihydro-1H-inden-2-yl)methyl]-1,2,3,4-tetrahydroquinolin-4-yl]-4-methyl-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | COc1cccc2c1CC(Cc1ccc3c(c1)C(NC(=O)C1Cc4c(C)cc(O)cc4N1)CCN3)C2 |
| InChI | InChI=1S/C30H33N3O3/c1-17-10-21(34)15-27-22(17)16-28(32-27)30(35)33-26-8-9-31-25-7-6-18(13-24(25)26)11-19-12-20-4-3-5-29(36-2)23(20)14-19/h3-7,10,13,15,19,26,28,31-32,34H,8-9,11-12,14,16H2,1-2H3,(H,33,35) |
| InChIKey | QXCYBKMYRUHPIK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |