C29H33N3O3 — CID 134352219
8-hydroxy-N-[6-[(4-methoxyphenyl)methyl]-1,2,3,4-tetrahydroquinolin-4-yl]-6-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine-4-carboxamide (PubChem CID 134352219) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is 8-hydroxy-N-[6-[(4-methoxyphenyl)methyl]-1,2,3,4-tetrahydroquinolin-4-yl]-6-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine-4-carboxamide.
| Compound Name | 8-hydroxy-N-[6-[(4-methoxyphenyl)methyl]-1,2,3,4-tetrahydroquinolin-4-yl]-6-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 134352219 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 8-hydroxy-N-[6-[(4-methoxyphenyl)methyl]-1,2,3,4-tetrahydroquinolin-4-yl]-6-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine-4-carboxamide |
| SMILES | COc1ccc(Cc2ccc3c(c2)C(NC(=O)C2Cc4c(C)cc(O)cc4CCN2)CCN3)cc1 |
| InChI | InChI=1S/C29H33N3O3/c1-18-13-22(33)16-21-9-11-31-28(17-24(18)21)29(34)32-27-10-12-30-26-8-5-20(15-25(26)27)14-19-3-6-23(35-2)7-4-19/h3-8,13,15-16,27-28,30-31,33H,9-12,14,17H2,1-2H3,(H,32,34) |
| InChIKey | MDUONCQXRDNMBV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |