C15H15Cl3FN3S — CID 134359705
N-(3-chloro-4-fluorophenyl)sulfanyl-N'-(3,5-dichloro-4-pyridinyl)-2-methylpropane-1,3-diamine (PubChem CID 134359705) has the molecular formula C15H15Cl3FN3S and a molecular weight of 394.73 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)sulfanyl-N'-(3,5-dichloro-4-pyridinyl)-2-methylpropane-1,3-diamine.
| Compound Name | N-(3-chloro-4-fluorophenyl)sulfanyl-N'-(3,5-dichloro-4-pyridinyl)-2-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 134359705 |
| Molecular Formula | C15H15Cl3FN3S |
| Molecular Weight | 394.73 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)sulfanyl-N'-(3,5-dichloro-4-pyridinyl)-2-methylpropane-1,3-diamine |
| SMILES | CC(CNSc1ccc(F)c(Cl)c1)CNc1c(Cl)cncc1Cl |
| InChI | InChI=1S/C15H15Cl3FN3S/c1-9(5-21-15-12(17)7-20-8-13(15)18)6-22-23-10-2-3-14(19)11(16)4-10/h2-4,7-9,22H,5-6H2,1H3,(H,20,21) |
| InChIKey | MEWZOVLLXBYMED-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.73 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|