C29H38N2O5S — CID 134359871
6-O-benzyl 1-O-tert-butyl 3-[2-(4-methylphenyl)sulfanyloxyethyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1,6-dicarboxylate (PubChem CID 134359871) has the molecular formula C29H38N2O5S and a molecular weight of 526.70 g/mol. Its IUPAC name is 6-O-benzyl 1-O-tert-butyl 3-[2-(4-methylphenyl)sulfanyloxyethyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1,6-dicarboxylate.
| Compound Name | 6-O-benzyl 1-O-tert-butyl 3-[2-(4-methylphenyl)sulfanyloxyethyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1,6-dicarboxylate |
|---|---|
| PubChem CID | 134359871 |
| Molecular Formula | C29H38N2O5S |
| Molecular Weight | 526.70 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | 6-O-benzyl 1-O-tert-butyl 3-[2-(4-methylphenyl)sulfanyloxyethyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1,6-dicarboxylate |
| SMILES | Cc1ccc(SOCCC2CN(C(=O)OC(C)(C)C)C3CN(C(=O)OCc4ccccc4)CCC23)cc1 |
| InChI | InChI=1S/C29H38N2O5S/c1-21-10-12-24(13-11-21)37-35-17-15-23-18-31(28(33)36-29(2,3)4)26-19-30(16-14-25(23)26)27(32)34-20-22-8-6-5-7-9-22/h5-13,23,25-26H,14-20H2,1-4H3 |
| InChIKey | UTELNLNXSPVRFU-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.70 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|