C13H18O4 — CID 13436256
3,3-dimethyl-1-oxo-6-propan-2-ylidene-4,5-dihydro-3aH-cyclopenta[c]furan-6a-carboxylic acid (PubChem CID 13436256) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 3,3-dimethyl-1-oxo-6-propan-2-ylidene-4,5-dihydro-3aH-cyclopenta[c]furan-6a-carboxylic acid.
| Compound Name | 3,3-dimethyl-1-oxo-6-propan-2-ylidene-4,5-dihydro-3aH-cyclopenta[c]furan-6a-carboxylic acid |
|---|---|
| PubChem CID | 13436256 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 3,3-dimethyl-1-oxo-6-propan-2-ylidene-4,5-dihydro-3aH-cyclopenta[c]furan-6a-carboxylic acid |
| SMILES | CC(C)=C1CCC2C(C)(C)OC(=O)C12C(=O)O |
| InChI | InChI=1S/C13H18O4/c1-7(2)8-5-6-9-12(3,4)17-11(16)13(8,9)10(14)15/h9H,5-6H2,1-4H3,(H,14,15) |
| InChIKey | MFCVAMDWTXOCTA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|