C9H12N4O3 — CID 134362981
2-[[2-(3-formamidoprop-1-en-2-ylamino)acetyl]amino]acetyl cyanide (PubChem CID 134362981) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is 2-[[2-(3-formamidoprop-1-en-2-ylamino)acetyl]amino]acetyl cyanide.
| Compound Name | 2-[[2-(3-formamidoprop-1-en-2-ylamino)acetyl]amino]acetyl cyanide |
|---|---|
| PubChem CID | 134362981 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 2-[[2-(3-formamidoprop-1-en-2-ylamino)acetyl]amino]acetyl cyanide |
| SMILES | C=C(CNC=O)NCC(=O)NCC(=O)C#N |
| InChI | InChI=1S/C9H12N4O3/c1-7(3-11-6-14)12-5-9(16)13-4-8(15)2-10/h6,12H,1,3-5H2,(H,11,14)(H,13,16) |
| InChIKey | AYGXSKMWHQFXGN-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 111.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|