C13H20FN — CID 134365582
4-(5-fluoro-4-methylidenehexa-1,5-dien-2-yl)-1-methylpiperidine (PubChem CID 134365582) has the molecular formula C13H20FN and a molecular weight of 209.31 g/mol. Its IUPAC name is 4-(5-fluoro-4-methylidenehexa-1,5-dien-2-yl)-1-methylpiperidine.
| Compound Name | 4-(5-fluoro-4-methylidenehexa-1,5-dien-2-yl)-1-methylpiperidine |
|---|---|
| PubChem CID | 134365582 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 4-(5-fluoro-4-methylidenehexa-1,5-dien-2-yl)-1-methylpiperidine |
| SMILES | C=C(F)C(=C)CC(=C)C1CCN(C)CC1 |
| InChI | InChI=1S/C13H20FN/c1-10(12(3)14)9-11(2)13-5-7-15(4)8-6-13/h13H,1-3,5-9H2,4H3 |
| InChIKey | CEKDZKCMELSEFE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|