C13H23F2N — CID 134531079
1-(1,2-difluoro-2,3-dimethylbut-3-enyl)-3,5-dimethylpiperidine (PubChem CID 134531079) has the molecular formula C13H23F2N and a molecular weight of 231.33 g/mol. Its IUPAC name is 1-(1,2-difluoro-2,3-dimethylbut-3-enyl)-3,5-dimethylpiperidine.
| Compound Name | 1-(1,2-difluoro-2,3-dimethylbut-3-enyl)-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 134531079 |
| Molecular Formula | C13H23F2N |
| Molecular Weight | 231.33 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 1-(1,2-difluoro-2,3-dimethylbut-3-enyl)-3,5-dimethylpiperidine |
| SMILES | C=C(C)C(C)(F)C(F)N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C13H23F2N/c1-9(2)13(5,15)12(14)16-7-10(3)6-11(4)8-16/h10-12H,1,6-8H2,2-5H3 |
| InChIKey | HQFAPMQROKBCAM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|