About 2-chloro-5-fluoro-N-methylcyclohexa-1,3-dien-1-amine
2-chloro-5-fluoro-N-methylcyclohexa-1,3-dien-1-amine (PubChem CID 134365771) has the molecular formula C7H9ClFN
and a molecular weight of 161.61 g/mol. Its IUPAC name is 2-chloro-5-fluoro-N-methylcyclohexa-1,3-dien-1-amine.
Analyze 2-chloro-5-fluoro-N-methylcyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-fluoro-N-methylcyclohexa-1,3-dien-1-amine?
The IUPAC name of 2-chloro-5-fluoro-N-methylcyclohexa-1,3-dien-1-amine (CID 134365771) is 2-chloro-5-fluoro-N-methylcyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 2-chloro-5-fluoro-N-methylcyclohexa-1,3-dien-1-amine?
The canonical SMILES for 2-chloro-5-fluoro-N-methylcyclohexa-1,3-dien-1-amine is CNC1=C(Cl)C=CC(F)C1.
What is the InChIKey of 2-chloro-5-fluoro-N-methylcyclohexa-1,3-dien-1-amine?
The InChIKey is JBSCNQMOQPJFJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClFN/c1-10-7-4-5(9)2-3-6(7)8/h2-3,5,10H,4H2,1H3.
What are the key properties of 2-chloro-5-fluoro-N-methylcyclohexa-1,3-dien-1-amine?
2-chloro-5-fluoro-N-methylcyclohexa-1,3-dien-1-amine has a molecular weight of 161.61 g/mol, XLogP of 1.95, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-fluoro-N-methylcyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 134365771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).