C8H12FN — CID 163848812
5-fluoro-N,2-dimethylcyclohexa-1,3-dien-1-amine (PubChem CID 163848812) has the molecular formula C8H12FN and a molecular weight of 141.19 g/mol. Its IUPAC name is 5-fluoro-N,2-dimethylcyclohexa-1,3-dien-1-amine.
| Compound Name | 5-fluoro-N,2-dimethylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 163848812 |
| Molecular Formula | C8H12FN |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | 5-fluoro-N,2-dimethylcyclohexa-1,3-dien-1-amine |
| SMILES | CNC1=C(C)C=CC(F)C1 |
| InChI | InChI=1S/C8H12FN/c1-6-3-4-7(9)5-8(6)10-2/h3-4,7,10H,5H2,1-2H3 |
| InChIKey | OSNUUIGRQANBNS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |