C9H13F2N3O5 — CID 134366143
[(2S,3R,4R)-4-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-1,3-dihydroxy-2-methoxybutan-2-yl] hypofluorite (PubChem CID 134366143) has the molecular formula C9H13F2N3O5 and a molecular weight of 281.21 g/mol. Its IUPAC name is [(2S,3R,4R)-4-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-1,3-dihydroxy-2-methoxybutan-2-yl] hypofluorite.
| Compound Name | [(2S,3R,4R)-4-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-1,3-dihydroxy-2-methoxybutan-2-yl] hypofluorite |
|---|---|
| PubChem CID | 134366143 |
| Molecular Formula | C9H13F2N3O5 |
| Molecular Weight | 281.21 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | [(2S,3R,4R)-4-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-1,3-dihydroxy-2-methoxybutan-2-yl] hypofluorite |
| SMILES | CO[C@@](CO)(OF)[C@@H](O)[C@@H](F)n1ccc(N)nc1=O |
| InChI | InChI=1S/C9H13F2N3O5/c1-18-9(4-15,19-11)6(16)7(10)14-3-2-5(12)13-8(14)17/h2-3,6-7,15-16H,4H2,1H3,(H2,12,13,17)/t6-,7-,9-/m0/s1 |
| InChIKey | RKTNACZUIFAABB-ZKWXMUAHSA-N |
| XLogP | -1.11 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.21 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|