C17H14N4O3 — CID 134366826
furan-3-carboxylic acid;2-pyridin-4-yl-3H-benzimidazol-5-amine (PubChem CID 134366826) has the molecular formula C17H14N4O3 and a molecular weight of 322.32 g/mol. Its IUPAC name is furan-3-carboxylic acid;2-pyridin-4-yl-3H-benzimidazol-5-amine.
| Compound Name | furan-3-carboxylic acid;2-pyridin-4-yl-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 134366826 |
| Molecular Formula | C17H14N4O3 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | furan-3-carboxylic acid;2-pyridin-4-yl-3H-benzimidazol-5-amine |
| SMILES | Nc1ccc2nc(-c3ccncc3)[nH]c2c1.O=C(O)c1ccoc1 |
| InChI | InChI=1S/C12H10N4.C5H4O3/c13-9-1-2-10-11(7-9)16-12(15-10)8-3-5-14-6-4-8;6-5(7)4-1-2-8-3-4/h1-7H,13H2,(H,15,16);1-3H,(H,6,7) |
| InChIKey | DLYIKBZDTZPJLC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 118.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|