C44H32F8O — CID 134371409
6-[4-[2-(4-butoxyphenyl)ethynyl]-2-fluoro-5-propylphenyl]-2-[4-(3,5-difluoro-4-methylphenyl)-3,5-difluorophenyl]-1,3,8-trifluoronaphthalene (PubChem CID 134371409) has the molecular formula C44H32F8O and a molecular weight of 728.72 g/mol. Its IUPAC name is 6-[4-[2-(4-butoxyphenyl)ethynyl]-2-fluoro-5-propylphenyl]-2-[4-(3,5-difluoro-4-methylphenyl)-3,5-difluorophenyl]-1,3,8-trifluoronaphthalene.
| Compound Name | 6-[4-[2-(4-butoxyphenyl)ethynyl]-2-fluoro-5-propylphenyl]-2-[4-(3,5-difluoro-4-methylphenyl)-3,5-difluorophenyl]-1,3,8-trifluoronaphthalene |
|---|---|
| PubChem CID | 134371409 |
| Molecular Formula | C44H32F8O |
| Molecular Weight | 728.72 g/mol |
| Exact Mass | 728.23 |
| IUPAC Name | 6-[4-[2-(4-butoxyphenyl)ethynyl]-2-fluoro-5-propylphenyl]-2-[4-(3,5-difluoro-4-methylphenyl)-3,5-difluorophenyl]-1,3,8-trifluoronaphthalene |
| SMILES | CCCCOc1ccc(C#Cc2cc(F)c(-c3cc(F)c4c(F)c(-c5cc(F)c(-c6cc(F)c(C)c(F)c6)c(F)c5)c(F)cc4c3)cc2CCC)cc1 |
| InChI | InChI=1S/C44H32F8O/c1-4-6-14-53-32-12-9-25(10-13-32)8-11-27-17-36(47)33(16-26(27)7-5-2)28-15-29-21-40(51)43(44(52)42(29)39(50)18-28)31-22-37(48)41(38(49)23-31)30-19-34(45)24(3)35(46)20-30/h9-10,12-13,15-23H,4-7,14H2,1-3H3 |
| InChIKey | PCOHPQNLOCFAKW-UHFFFAOYSA-N |
| XLogP | 12.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.72 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|