C35H23F11OS — CID 134375919
[4-[2-[4-[6-(4-butoxyphenyl)-1,3,8-trifluoronaphthalen-2-yl]-2-fluoro-6-methylphenyl]ethynyl]-2,6-difluorophenyl]-pentafluoro-λ6-sulfane (PubChem CID 134375919) has the molecular formula C35H23F11OS and a molecular weight of 700.61 g/mol. Its IUPAC name is [4-[2-[4-[6-(4-butoxyphenyl)-1,3,8-trifluoronaphthalen-2-yl]-2-fluoro-6-methylphenyl]ethynyl]-2,6-difluorophenyl]-pentafluoro-λ6-sulfane.
| Compound Name | [4-[2-[4-[6-(4-butoxyphenyl)-1,3,8-trifluoronaphthalen-2-yl]-2-fluoro-6-methylphenyl]ethynyl]-2,6-difluorophenyl]-pentafluoro-λ6-sulfane |
|---|---|
| PubChem CID | 134375919 |
| Molecular Formula | C35H23F11OS |
| Molecular Weight | 700.61 g/mol |
| Exact Mass | 700.13 |
| IUPAC Name | [4-[2-[4-[6-(4-butoxyphenyl)-1,3,8-trifluoronaphthalen-2-yl]-2-fluoro-6-methylphenyl]ethynyl]-2,6-difluorophenyl]-pentafluoro-λ6-sulfane |
| SMILES | CCCCOc1ccc(-c2cc(F)c3c(F)c(-c4cc(C)c(C#Cc5cc(F)c(S(F)(F)(F)(F)F)c(F)c5)c(F)c4)c(F)cc3c2)cc1 |
| InChI | InChI=1S/C35H23F11OS/c1-3-4-11-47-25-8-6-21(7-9-25)22-15-24-18-29(38)32(34(41)33(24)28(37)16-22)23-12-19(2)26(27(36)17-23)10-5-20-13-30(39)35(31(40)14-20)48(42,43,44,45)46/h6-9,12-18H,3-4,11H2,1-2H3 |
| InChIKey | YBDAEEUZVJYSDB-UHFFFAOYSA-N |
| XLogP | 12.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.61 |
| LogP ≤ 5 | 12.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|