C26H30O3 — CID 134374949
[4-[4-[4-(3-methyl-2-oxobut-3-enyl)phenyl]phenyl]cyclohexyl] propanoate (PubChem CID 134374949) has the molecular formula C26H30O3 and a molecular weight of 390.52 g/mol. Its IUPAC name is [4-[4-[4-(3-methyl-2-oxobut-3-enyl)phenyl]phenyl]cyclohexyl] propanoate.
| Compound Name | [4-[4-[4-(3-methyl-2-oxobut-3-enyl)phenyl]phenyl]cyclohexyl] propanoate |
|---|---|
| PubChem CID | 134374949 |
| Molecular Formula | C26H30O3 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | [4-[4-[4-(3-methyl-2-oxobut-3-enyl)phenyl]phenyl]cyclohexyl] propanoate |
| SMILES | C=C(C)C(=O)Cc1ccc(-c2ccc(C3CCC(OC(=O)CC)CC3)cc2)cc1 |
| InChI | InChI=1S/C26H30O3/c1-4-26(28)29-24-15-13-23(14-16-24)22-11-9-21(10-12-22)20-7-5-19(6-8-20)17-25(27)18(2)3/h5-12,23-24H,2,4,13-17H2,1,3H3 |
| InChIKey | VYZDXUUIISQELD-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|