C31H39N5O3S — CID 134375416
tert-butyl 4-[9-(dimethylaminosulfanyl)-6,6-dimethyl-3-(methyliminomethyl)-11-oxo-5H-benzo[b]carbazol-8-yl]piperazine-1-carboxylate (PubChem CID 134375416) has the molecular formula C31H39N5O3S and a molecular weight of 561.75 g/mol. Its IUPAC name is tert-butyl 4-[9-(dimethylaminosulfanyl)-6,6-dimethyl-3-(methyliminomethyl)-11-oxo-5H-benzo[b]carbazol-8-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[9-(dimethylaminosulfanyl)-6,6-dimethyl-3-(methyliminomethyl)-11-oxo-5H-benzo[b]carbazol-8-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 134375416 |
| Molecular Formula | C31H39N5O3S |
| Molecular Weight | 561.75 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | tert-butyl 4-[9-(dimethylaminosulfanyl)-6,6-dimethyl-3-(methyliminomethyl)-11-oxo-5H-benzo[b]carbazol-8-yl]piperazine-1-carboxylate |
| SMILES | C/N=C/c1ccc2c3c([nH]c2c1)C(C)(C)c1cc(N2CCN(C(=O)OC(C)(C)C)CC2)c(SN(C)C)cc1C3=O |
| InChI | InChI=1S/C31H39N5O3S/c1-30(2,3)39-29(38)36-13-11-35(12-14-36)24-17-22-21(16-25(24)40-34(7)8)27(37)26-20-10-9-19(18-32-6)15-23(20)33-28(26)31(22,4)5/h9-10,15-18,33H,11-14H2,1-8H3/b32-18+ |
| InChIKey | YDNLLXJTSULFLB-KCSSXMTESA-N |
| XLogP | 5.71 |
| TPSA | 81.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.75 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|