C26H29N3O2 — CID 167193340
9-ethyl-6,6-dimethyl-3-(methyliminomethyl)-8-morpholin-4-yl-5H-benzo[b]carbazol-11-one (PubChem CID 167193340) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 9-ethyl-6,6-dimethyl-3-(methyliminomethyl)-8-morpholin-4-yl-5H-benzo[b]carbazol-11-one.
| Compound Name | 9-ethyl-6,6-dimethyl-3-(methyliminomethyl)-8-morpholin-4-yl-5H-benzo[b]carbazol-11-one |
|---|---|
| PubChem CID | 167193340 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 9-ethyl-6,6-dimethyl-3-(methyliminomethyl)-8-morpholin-4-yl-5H-benzo[b]carbazol-11-one |
| SMILES | CCc1cc2c(cc1N1CCOCC1)C(C)(C)c1[nH]c3cc(/C=N/C)ccc3c1C2=O |
| InChI | InChI=1S/C26H29N3O2/c1-5-17-13-19-20(14-22(17)29-8-10-31-11-9-29)26(2,3)25-23(24(19)30)18-7-6-16(15-27-4)12-21(18)28-25/h6-7,12-15,28H,5,8-11H2,1-4H3/b27-15+ |
| InChIKey | ZZFUSXKDCAEFEW-JFLMPSFJSA-N |
| XLogP | 4.49 |
| TPSA | 57.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|