C29H34N4O — CID 134375553
8-(4-cyclobutylpiperazin-1-yl)-6,6,9-trimethyl-3-(methyliminomethyl)-5H-benzo[b]carbazol-11-one (PubChem CID 134375553) has the molecular formula C29H34N4O and a molecular weight of 454.62 g/mol. Its IUPAC name is 8-(4-cyclobutylpiperazin-1-yl)-6,6,9-trimethyl-3-(methyliminomethyl)-5H-benzo[b]carbazol-11-one.
| Compound Name | 8-(4-cyclobutylpiperazin-1-yl)-6,6,9-trimethyl-3-(methyliminomethyl)-5H-benzo[b]carbazol-11-one |
|---|---|
| PubChem CID | 134375553 |
| Molecular Formula | C29H34N4O |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 8-(4-cyclobutylpiperazin-1-yl)-6,6,9-trimethyl-3-(methyliminomethyl)-5H-benzo[b]carbazol-11-one |
| SMILES | C/N=C/c1ccc2c3c([nH]c2c1)C(C)(C)c1cc(N2CCN(C4CCC4)CC2)c(C)cc1C3=O |
| InChI | InChI=1S/C29H34N4O/c1-18-14-22-23(16-25(18)33-12-10-32(11-13-33)20-6-5-7-20)29(2,3)28-26(27(22)34)21-9-8-19(17-30-4)15-24(21)31-28/h8-9,14-17,20,31H,5-7,10-13H2,1-4H3/b30-17+ |
| InChIKey | WJGQXVLIJYVHJK-OCSSWDANSA-N |
| XLogP | 5.07 |
| TPSA | 51.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|