C30H36N4O — CID 135211224
8-(4-cyclobutylpiperazin-1-yl)-9-ethyl-6,6-dimethyl-3-(methyliminomethyl)-5H-benzo[b]carbazol-11-one (PubChem CID 135211224) has the molecular formula C30H36N4O and a molecular weight of 468.65 g/mol. Its IUPAC name is 8-(4-cyclobutylpiperazin-1-yl)-9-ethyl-6,6-dimethyl-3-(methyliminomethyl)-5H-benzo[b]carbazol-11-one.
| Compound Name | 8-(4-cyclobutylpiperazin-1-yl)-9-ethyl-6,6-dimethyl-3-(methyliminomethyl)-5H-benzo[b]carbazol-11-one |
|---|---|
| PubChem CID | 135211224 |
| Molecular Formula | C30H36N4O |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | 8-(4-cyclobutylpiperazin-1-yl)-9-ethyl-6,6-dimethyl-3-(methyliminomethyl)-5H-benzo[b]carbazol-11-one |
| SMILES | CCc1cc2c(cc1N1CCN(C3CCC3)CC1)C(C)(C)c1[nH]c3cc(/C=N/C)ccc3c1C2=O |
| InChI | InChI=1S/C30H36N4O/c1-5-20-16-23-24(17-26(20)34-13-11-33(12-14-34)21-7-6-8-21)30(2,3)29-27(28(23)35)22-10-9-19(18-31-4)15-25(22)32-29/h9-10,15-18,21,32H,5-8,11-14H2,1-4H3/b31-18+ |
| InChIKey | SHPAYTCKZWSIEP-FDAWAROLSA-N |
| XLogP | 5.32 |
| TPSA | 51.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|