C20H21NO2 — CID 134376167
8-methoxy-5,6,6-trimethyl-4,4a-dihydrobenzo[b]carbazol-11-one (PubChem CID 134376167) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 8-methoxy-5,6,6-trimethyl-4,4a-dihydrobenzo[b]carbazol-11-one.
| Compound Name | 8-methoxy-5,6,6-trimethyl-4,4a-dihydrobenzo[b]carbazol-11-one |
|---|---|
| PubChem CID | 134376167 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 8-methoxy-5,6,6-trimethyl-4,4a-dihydrobenzo[b]carbazol-11-one |
| SMILES | COc1ccc2c(c1)C(C)(C)C1=C(C2=O)C2=CC=CCC2N1C |
| InChI | InChI=1S/C20H21NO2/c1-20(2)15-11-12(23-4)9-10-13(15)18(22)17-14-7-5-6-8-16(14)21(3)19(17)20/h5-7,9-11,16H,8H2,1-4H3 |
| InChIKey | ZIHNWMRUQAHBAI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |