C13H21N3 — CID 134377458
(Z)-N-(1-cyclopropylethenyl)-N'-[(E)-2-(methylamino)prop-1-enyl]but-2-enimidamide (PubChem CID 134377458) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is (Z)-N-(1-cyclopropylethenyl)-N'-[(E)-2-(methylamino)prop-1-enyl]but-2-enimidamide.
| Compound Name | (Z)-N-(1-cyclopropylethenyl)-N'-[(E)-2-(methylamino)prop-1-enyl]but-2-enimidamide |
|---|---|
| PubChem CID | 134377458 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | (Z)-N-(1-cyclopropylethenyl)-N'-[(E)-2-(methylamino)prop-1-enyl]but-2-enimidamide |
| SMILES | C=C(NC(/C=C\C)=N/C=C(\C)NC)C1CC1 |
| InChI | InChI=1S/C13H21N3/c1-5-6-13(15-9-10(2)14-4)16-11(3)12-7-8-12/h5-6,9,12,14H,3,7-8H2,1-2,4H3,(H,15,16)/b6-5-,10-9+ |
| InChIKey | FXZCDXUCOODXNO-MLCWLASSSA-N |
| XLogP | 2.56 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|