C13H24N2 — CID 144655472
(2Z)-N-(cyclopropylmethyl)-N',3-dimethylpenta-2,4-dienimidamide;ethane (PubChem CID 144655472) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is (2Z)-N-(cyclopropylmethyl)-N',3-dimethylpenta-2,4-dienimidamide;ethane.
| Compound Name | (2Z)-N-(cyclopropylmethyl)-N',3-dimethylpenta-2,4-dienimidamide;ethane |
|---|---|
| PubChem CID | 144655472 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | (2Z)-N-(cyclopropylmethyl)-N',3-dimethylpenta-2,4-dienimidamide;ethane |
| SMILES | C=C/C(C)=C\C(=N/C)NCC1CC1.CC |
| InChI | InChI=1S/C11H18N2.C2H6/c1-4-9(2)7-11(12-3)13-8-10-5-6-10;1-2/h4,7,10H,1,5-6,8H2,2-3H3,(H,12,13);1-2H3/b9-7-; |
| InChIKey | KBRUAGHHVCMPSB-VILQZVERSA-N |
| XLogP | 3.17 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|