C5H12NO3S- — CID 134379133
2-[2-(methylamino)ethoxy]ethanesulfinate (PubChem CID 134379133) has the molecular formula C5H12NO3S- and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-[2-(methylamino)ethoxy]ethanesulfinate.
| Compound Name | 2-[2-(methylamino)ethoxy]ethanesulfinate |
|---|---|
| PubChem CID | 134379133 |
| Molecular Formula | C5H12NO3S- |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 2-[2-(methylamino)ethoxy]ethanesulfinate |
| SMILES | CNCCOCCS(=O)[O-] |
| InChI | InChI=1S/C5H13NO3S/c1-6-2-3-9-4-5-10(7)8/h6H,2-5H2,1H3,(H,7,8)/p-1 |
| InChIKey | NRQQDNQPGJGQHD-UHFFFAOYSA-M |
| XLogP | -0.90 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|