C5H13NO3S — CID 134379134
2-[2-(methylamino)ethoxy]ethanesulfinic acid (PubChem CID 134379134) has the molecular formula C5H13NO3S and a molecular weight of 167.23 g/mol. Its IUPAC name is 2-[2-(methylamino)ethoxy]ethanesulfinic acid.
| Compound Name | 2-[2-(methylamino)ethoxy]ethanesulfinic acid |
|---|---|
| PubChem CID | 134379134 |
| Molecular Formula | C5H13NO3S |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 2-[2-(methylamino)ethoxy]ethanesulfinic acid |
| SMILES | CNCCOCCS(=O)O |
| InChI | InChI=1S/C5H13NO3S/c1-6-2-3-9-4-5-10(7)8/h6H,2-5H2,1H3,(H,7,8) |
| InChIKey | NRQQDNQPGJGQHD-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|