C23H30N4O3 — CID 134379686
[4-[2-(dimethylamino)-2-oxoethyl]phenyl] 4-(diaminomethylideneamino)-2-(2,2-dimethylpropyl)benzoate (PubChem CID 134379686) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is [4-[2-(dimethylamino)-2-oxoethyl]phenyl] 4-(diaminomethylideneamino)-2-(2,2-dimethylpropyl)benzoate.
| Compound Name | [4-[2-(dimethylamino)-2-oxoethyl]phenyl] 4-(diaminomethylideneamino)-2-(2,2-dimethylpropyl)benzoate |
|---|---|
| PubChem CID | 134379686 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | [4-[2-(dimethylamino)-2-oxoethyl]phenyl] 4-(diaminomethylideneamino)-2-(2,2-dimethylpropyl)benzoate |
| SMILES | CN(C)C(=O)Cc1ccc(OC(=O)c2ccc(N=C(N)N)cc2CC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H30N4O3/c1-23(2,3)14-16-13-17(26-22(24)25)8-11-19(16)21(29)30-18-9-6-15(7-10-18)12-20(28)27(4)5/h6-11,13H,12,14H2,1-5H3,(H4,24,25,26) |
| InChIKey | CMUYEIAJTZWIFS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|