C10H14F5NO — CID 134384157
4-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)morpholine (PubChem CID 134384157) has the molecular formula C10H14F5NO and a molecular weight of 259.22 g/mol. Its IUPAC name is 4-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)morpholine.
| Compound Name | 4-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)morpholine |
|---|---|
| PubChem CID | 134384157 |
| Molecular Formula | C10H14F5NO |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 4-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)morpholine |
| SMILES | C=C(C)C(F)(F)C(F)C(F)(F)N1CCOCC1 |
| InChI | InChI=1S/C10H14F5NO/c1-7(2)9(12,13)8(11)10(14,15)16-3-5-17-6-4-16/h8H,1,3-6H2,2H3 |
| InChIKey | FSOFZQSDBWIWEM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|