C23H19F7O3 — CID 134386204
2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]cyclohex-3-en-1-yl]-1,3-dioxane (PubChem CID 134386204) has the molecular formula C23H19F7O3 and a molecular weight of 476.39 g/mol. Its IUPAC name is 2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]cyclohex-3-en-1-yl]-1,3-dioxane.
| Compound Name | 2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]cyclohex-3-en-1-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 134386204 |
| Molecular Formula | C23H19F7O3 |
| Molecular Weight | 476.39 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]cyclohex-3-en-1-yl]-1,3-dioxane |
| SMILES | Fc1cc(OC(F)(F)c2c(F)cc(C3=CCC(C4OCCCO4)CC3)cc2F)cc(F)c1F |
| InChI | InChI=1S/C23H19F7O3/c24-16-8-14(12-2-4-13(5-3-12)22-31-6-1-7-32-22)9-17(25)20(16)23(29,30)33-15-10-18(26)21(28)19(27)11-15/h2,8-11,13,22H,1,3-7H2 |
| InChIKey | SDRNYSGYLUCGDR-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.39 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|