About (2R)-N,7-dimethyl-4-oxo-2-propan-2-yl-3-prop-1-en-2-yloctanamide
(2R)-N,7-dimethyl-4-oxo-2-propan-2-yl-3-prop-1-en-2-yloctanamide (PubChem CID 134389777) has the molecular formula C16H29NO2
and a molecular weight of 267.41 g/mol. Its IUPAC name is (2R)-N,7-dimethyl-4-oxo-2-propan-2-yl-3-prop-1-en-2-yloctanamide.
Molecular Properties
| Compound Name | (2R)-N,7-dimethyl-4-oxo-2-propan-2-yl-3-prop-1-en-2-yloctanamide |
| PubChem CID | 134389777 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | (2R)-N,7-dimethyl-4-oxo-2-propan-2-yl-3-prop-1-en-2-yloctanamide |
| SMILES | C=C(C)C(C(=O)CCC(C)C)[C@H](C(=O)NC)C(C)C |
| InChI | InChI=1S/C16H29NO2/c1-10(2)8-9-13(18)14(11(3)4)15(12(5)6)16(19)17-7/h10,12,14-15H,3,8-9H2,1-2,4-7H3,(H,17,19)/t14?,15-/m1/s1 |
| InChIKey | JJKZOYTYECUSRH-YSSOQSIOSA-N |
| XLogP | 3.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-N,7-dimethyl-4-oxo-2-propan-2-yl-3-prop-1-en-2-yloctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N,7-dimethyl-4-oxo-2-propan-2-yl-3-prop-1-en-2-yloctanamide?
The IUPAC name of (2R)-N,7-dimethyl-4-oxo-2-propan-2-yl-3-prop-1-en-2-yloctanamide (CID 134389777) is (2R)-N,7-dimethyl-4-oxo-2-propan-2-yl-3-prop-1-en-2-yloctanamide.
What is the SMILES notation for (2R)-N,7-dimethyl-4-oxo-2-propan-2-yl-3-prop-1-en-2-yloctanamide?
The canonical SMILES for (2R)-N,7-dimethyl-4-oxo-2-propan-2-yl-3-prop-1-en-2-yloctanamide is C=C(C)C(C(=O)CCC(C)C)[C@H](C(=O)NC)C(C)C.
What is the InChIKey of (2R)-N,7-dimethyl-4-oxo-2-propan-2-yl-3-prop-1-en-2-yloctanamide?
The InChIKey is JJKZOYTYECUSRH-YSSOQSIOSA-N. The full InChI is InChI=1S/C16H29NO2/c1-10(2)8-9-13(18)14(11(3)4)15(12(5)6)16(19)17-7/h10,12,14-15H,3,8-9H2,1-2,4-7H3,(H,17,19)/t14?,15-/m1/s1.
What are the key properties of (2R)-N,7-dimethyl-4-oxo-2-propan-2-yl-3-prop-1-en-2-yloctanamide?
(2R)-N,7-dimethyl-4-oxo-2-propan-2-yl-3-prop-1-en-2-yloctanamide has a molecular weight of 267.41 g/mol, XLogP of 3.20, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N,7-dimethyl-4-oxo-2-propan-2-yl-3-prop-1-en-2-yloctanamide is sourced from PubChem (CID 134389777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).