C20H25NOSi — CID 13439172
[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-phenylphenyl]-trimethylsilane (PubChem CID 13439172) has the molecular formula C20H25NOSi and a molecular weight of 323.51 g/mol. Its IUPAC name is [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-phenylphenyl]-trimethylsilane.
| Compound Name | [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-phenylphenyl]-trimethylsilane |
|---|---|
| PubChem CID | 13439172 |
| Molecular Formula | C20H25NOSi |
| Molecular Weight | 323.51 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-phenylphenyl]-trimethylsilane |
| SMILES | CC1(C)COC(c2c(-c3ccccc3)cccc2[Si](C)(C)C)=N1 |
| InChI | InChI=1S/C20H25NOSi/c1-20(2)14-22-19(21-20)18-16(15-10-7-6-8-11-15)12-9-13-17(18)23(3,4)5/h6-13H,14H2,1-5H3 |
| InChIKey | NPYMEAZUSAGVFS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|