C35H54N4O5 — CID 134394719
N-butyl-N-(2,2-dimethoxyethyl)-3-[2-[3-[2-[4-(6-methyl-2-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]ethyl]phenyl]ethoxy]propanamide (PubChem CID 134394719) has the molecular formula C35H54N4O5 and a molecular weight of 610.84 g/mol. Its IUPAC name is N-butyl-N-(2,2-dimethoxyethyl)-3-[2-[3-[2-[4-(6-methyl-2-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]ethyl]phenyl]ethoxy]propanamide.
| Compound Name | N-butyl-N-(2,2-dimethoxyethyl)-3-[2-[3-[2-[4-(6-methyl-2-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]ethyl]phenyl]ethoxy]propanamide |
|---|---|
| PubChem CID | 134394719 |
| Molecular Formula | C35H54N4O5 |
| Molecular Weight | 610.84 g/mol |
| Exact Mass | 610.41 |
| IUPAC Name | N-butyl-N-(2,2-dimethoxyethyl)-3-[2-[3-[2-[4-(6-methyl-2-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]ethyl]phenyl]ethoxy]propanamide |
| SMILES | CCCCN(CC(OC)OC)C(=O)CCOCCc1cccc(CCN2CCC3(CC2)CN(c2cccc(C)n2)CCO3)c1 |
| InChI | InChI=1S/C35H54N4O5/c1-5-6-18-38(27-34(41-3)42-4)33(40)15-24-43-23-14-31-11-8-10-30(26-31)13-19-37-20-16-35(17-21-37)28-39(22-25-44-35)32-12-7-9-29(2)36-32/h7-12,26,34H,5-6,13-25,27-28H2,1-4H3 |
| InChIKey | RGJQSLCRUKKOKI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 76.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.84 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|