C11H13N3 — CID 134395107
N-[(1Z,3E)-3-(5-methylpyrimidin-2-yl)penta-1,3-dienyl]methanimine (PubChem CID 134395107) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is N-[(1Z,3E)-3-(5-methylpyrimidin-2-yl)penta-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z,3E)-3-(5-methylpyrimidin-2-yl)penta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 134395107 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | N-[(1Z,3E)-3-(5-methylpyrimidin-2-yl)penta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C\C(=C/C)c1ncc(C)cn1 |
| InChI | InChI=1S/C11H13N3/c1-4-10(5-6-12-3)11-13-7-9(2)8-14-11/h4-8H,3H2,1-2H3/b6-5-,10-4+ |
| InChIKey | WBFGXALMHWWTDN-QYONPMAVSA-N |
| XLogP | 2.40 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|