C12H24N2 — CID 134401021
1-N-methyl-1-N-(4-methylpent-2-ynyl)pentane-1,3-diamine (PubChem CID 134401021) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 1-N-methyl-1-N-(4-methylpent-2-ynyl)pentane-1,3-diamine.
| Compound Name | 1-N-methyl-1-N-(4-methylpent-2-ynyl)pentane-1,3-diamine |
|---|---|
| PubChem CID | 134401021 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 1-N-methyl-1-N-(4-methylpent-2-ynyl)pentane-1,3-diamine |
| SMILES | CCC(N)CCN(C)CC#CC(C)C |
| InChI | InChI=1S/C12H24N2/c1-5-12(13)8-10-14(4)9-6-7-11(2)3/h11-12H,5,8-10,13H2,1-4H3 |
| InChIKey | QOUTYQSTFCRWNV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|