C16H32N2 — CID 166118187
N'-ethyl-N-methyl-N'-(3-methylbutyl)-N-(4-methylpent-2-ynyl)ethane-1,2-diamine (PubChem CID 166118187) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is N'-ethyl-N-methyl-N'-(3-methylbutyl)-N-(4-methylpent-2-ynyl)ethane-1,2-diamine.
| Compound Name | N'-ethyl-N-methyl-N'-(3-methylbutyl)-N-(4-methylpent-2-ynyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 166118187 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | N'-ethyl-N-methyl-N'-(3-methylbutyl)-N-(4-methylpent-2-ynyl)ethane-1,2-diamine |
| SMILES | CCN(CCC(C)C)CCN(C)CC#CC(C)C |
| InChI | InChI=1S/C16H32N2/c1-7-18(12-10-16(4)5)14-13-17(6)11-8-9-15(2)3/h15-16H,7,10-14H2,1-6H3 |
| InChIKey | XECKCLVYIHCOND-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|