C21H28N6O3S3 — CID 134402984
2-hydroxy-5-methyl-3-methylidene-N-[5-[2-[5-(3-methylpent-4-enoylamino)-1,3,4-thiadiazol-2-yl]ethylsulfanylmethyl]-1,3,4-thiadiazol-2-yl]hex-4-enamide (PubChem CID 134402984) has the molecular formula C21H28N6O3S3 and a molecular weight of 508.70 g/mol. Its IUPAC name is 2-hydroxy-5-methyl-3-methylidene-N-[5-[2-[5-(3-methylpent-4-enoylamino)-1,3,4-thiadiazol-2-yl]ethylsulfanylmethyl]-1,3,4-thiadiazol-2-yl]hex-4-enamide.
| Compound Name | 2-hydroxy-5-methyl-3-methylidene-N-[5-[2-[5-(3-methylpent-4-enoylamino)-1,3,4-thiadiazol-2-yl]ethylsulfanylmethyl]-1,3,4-thiadiazol-2-yl]hex-4-enamide |
|---|---|
| PubChem CID | 134402984 |
| Molecular Formula | C21H28N6O3S3 |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | 2-hydroxy-5-methyl-3-methylidene-N-[5-[2-[5-(3-methylpent-4-enoylamino)-1,3,4-thiadiazol-2-yl]ethylsulfanylmethyl]-1,3,4-thiadiazol-2-yl]hex-4-enamide |
| SMILES | C=CC(C)CC(=O)Nc1nnc(CCSCc2nnc(NC(=O)C(O)C(=C)C=C(C)C)s2)s1 |
| InChI | InChI=1S/C21H28N6O3S3/c1-6-13(4)10-15(28)22-20-26-24-16(32-20)7-8-31-11-17-25-27-21(33-17)23-19(30)18(29)14(5)9-12(2)3/h6,9,13,18,29H,1,5,7-8,10-11H2,2-4H3,(H,22,26,28)(H,23,27,30) |
| InChIKey | LSIXJUBLQMJHAO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 129.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|