C23H31N7O3S3 — CID 144641062
(3Z,5Z)-3-ethenyl-N-[5-[2-[2-[5-[(2-formamido-3-methylbutanoyl)amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]hepta-3,5-dienamide (PubChem CID 144641062) has the molecular formula C23H31N7O3S3 and a molecular weight of 549.75 g/mol. Its IUPAC name is (3Z,5Z)-3-ethenyl-N-[5-[2-[2-[5-[(2-formamido-3-methylbutanoyl)amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]hepta-3,5-dienamide.
| Compound Name | (3Z,5Z)-3-ethenyl-N-[5-[2-[2-[5-[(2-formamido-3-methylbutanoyl)amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]hepta-3,5-dienamide |
|---|---|
| PubChem CID | 144641062 |
| Molecular Formula | C23H31N7O3S3 |
| Molecular Weight | 549.75 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | (3Z,5Z)-3-ethenyl-N-[5-[2-[2-[5-[(2-formamido-3-methylbutanoyl)amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]hepta-3,5-dienamide |
| SMILES | C=C/C(=C\C=C/C)CC(=O)Nc1nnc(CCSCCc2nnc(NC(=O)C(NC=O)C(C)C)s2)s1 |
| InChI | InChI=1S/C23H31N7O3S3/c1-5-7-8-16(6-2)13-17(32)25-22-29-27-18(35-22)9-11-34-12-10-19-28-30-23(36-19)26-21(33)20(15(3)4)24-14-31/h5-8,14-15,20H,2,9-13H2,1,3-4H3,(H,24,31)(H,25,29,32)(H,26,30,33)/b7-5-,16-8+ |
| InChIKey | VNMZPGPUTZDTPC-ACKKYSEPSA-N |
| XLogP | 3.63 |
| TPSA | 138.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.75 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|