C26H32N6O2S3 — CID 134403064
(3Z,5Z)-N-[5-[2-[2-[5-[(2-cyclohexa-1,5-dien-1-ylacetyl)amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]-3-ethenyl-N-methylhepta-3,5-dienamide (PubChem CID 134403064) has the molecular formula C26H32N6O2S3 and a molecular weight of 556.78 g/mol. Its IUPAC name is (3Z,5Z)-N-[5-[2-[2-[5-[(2-cyclohexa-1,5-dien-1-ylacetyl)amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]-3-ethenyl-N-methylhepta-3,5-dienamide.
| Compound Name | (3Z,5Z)-N-[5-[2-[2-[5-[(2-cyclohexa-1,5-dien-1-ylacetyl)amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]-3-ethenyl-N-methylhepta-3,5-dienamide |
|---|---|
| PubChem CID | 134403064 |
| Molecular Formula | C26H32N6O2S3 |
| Molecular Weight | 556.78 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | (3Z,5Z)-N-[5-[2-[2-[5-[(2-cyclohexa-1,5-dien-1-ylacetyl)amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]-3-ethenyl-N-methylhepta-3,5-dienamide |
| SMILES | C=C/C(=C\C=C/C)CC(=O)N(C)c1nnc(CCSCCc2nnc(NC(=O)CC3=CCCC=C3)s2)s1 |
| InChI | InChI=1S/C26H32N6O2S3/c1-4-6-10-19(5-2)18-24(34)32(3)26-31-29-23(37-26)14-16-35-15-13-22-28-30-25(36-22)27-21(33)17-20-11-8-7-9-12-20/h4-6,8,10-12H,2,7,9,13-18H2,1,3H3,(H,27,30,33)/b6-4-,19-10+ |
| InChIKey | WSBQQMUHTCEKQP-NSFRZYPPSA-N |
| XLogP | 5.55 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.78 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|