C22H36N2O7 — CID 134403550
1-[2-[2-[2-[2-[3-oxo-3-[(3S)-3-propan-2-ylpyrrolidin-1-yl]propoxy]ethoxy]ethoxy]ethoxy]ethyl]pyrrole-2,5-dione (PubChem CID 134403550) has the molecular formula C22H36N2O7 and a molecular weight of 440.54 g/mol. Its IUPAC name is 1-[2-[2-[2-[2-[3-oxo-3-[(3S)-3-propan-2-ylpyrrolidin-1-yl]propoxy]ethoxy]ethoxy]ethoxy]ethyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-[2-[2-[2-[3-oxo-3-[(3S)-3-propan-2-ylpyrrolidin-1-yl]propoxy]ethoxy]ethoxy]ethoxy]ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 134403550 |
| Molecular Formula | C22H36N2O7 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 1-[2-[2-[2-[2-[3-oxo-3-[(3S)-3-propan-2-ylpyrrolidin-1-yl]propoxy]ethoxy]ethoxy]ethoxy]ethyl]pyrrole-2,5-dione |
| SMILES | CC(C)[C@@H]1CCN(C(=O)CCOCCOCCOCCOCCN2C(=O)C=CC2=O)C1 |
| InChI | InChI=1S/C22H36N2O7/c1-18(2)19-5-7-23(17-19)20(25)6-9-28-11-13-30-15-16-31-14-12-29-10-8-24-21(26)3-4-22(24)27/h3-4,18-19H,5-17H2,1-2H3/t19-/m1/s1 |
| InChIKey | TZDCWPQNLIEQMG-LJQANCHMSA-N |
| XLogP | 0.87 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|