C31H35F5S — CID 134408799
3,4-difluoro-6-propyl-2-[2-[4-[4-(3,4,5-trifluorophenyl)cyclohexyl]cyclohexyl]ethyl]-1-benzothiophene (PubChem CID 134408799) has the molecular formula C31H35F5S and a molecular weight of 534.68 g/mol. Its IUPAC name is 3,4-difluoro-6-propyl-2-[2-[4-[4-(3,4,5-trifluorophenyl)cyclohexyl]cyclohexyl]ethyl]-1-benzothiophene.
| Compound Name | 3,4-difluoro-6-propyl-2-[2-[4-[4-(3,4,5-trifluorophenyl)cyclohexyl]cyclohexyl]ethyl]-1-benzothiophene |
|---|---|
| PubChem CID | 134408799 |
| Molecular Formula | C31H35F5S |
| Molecular Weight | 534.68 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | 3,4-difluoro-6-propyl-2-[2-[4-[4-(3,4,5-trifluorophenyl)cyclohexyl]cyclohexyl]ethyl]-1-benzothiophene |
| SMILES | CCCc1cc(F)c2c(F)c(CCC3CCC(C4CCC(c5cc(F)c(F)c(F)c5)CC4)CC3)sc2c1 |
| InChI | InChI=1S/C31H35F5S/c1-2-3-19-14-24(32)29-28(15-19)37-27(31(29)36)13-6-18-4-7-20(8-5-18)21-9-11-22(12-10-21)23-16-25(33)30(35)26(34)17-23/h14-18,20-22H,2-13H2,1H3 |
| InChIKey | KOECBEGNPNRCPF-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.68 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|