C16H27N3O5 — CID 134420255
N,N,N'-trimethyl-N'-[2-[methyl-(2-methyl-3-oxobutanoyl)amino]ethyl]-3-oxopentanediamide (PubChem CID 134420255) has the molecular formula C16H27N3O5 and a molecular weight of 341.41 g/mol. Its IUPAC name is N,N,N'-trimethyl-N'-[2-[methyl-(2-methyl-3-oxobutanoyl)amino]ethyl]-3-oxopentanediamide.
| Compound Name | N,N,N'-trimethyl-N'-[2-[methyl-(2-methyl-3-oxobutanoyl)amino]ethyl]-3-oxopentanediamide |
|---|---|
| PubChem CID | 134420255 |
| Molecular Formula | C16H27N3O5 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | N,N,N'-trimethyl-N'-[2-[methyl-(2-methyl-3-oxobutanoyl)amino]ethyl]-3-oxopentanediamide |
| SMILES | CC(=O)C(C)C(=O)N(C)CCN(C)C(=O)CC(=O)CC(=O)N(C)C |
| InChI | InChI=1S/C16H27N3O5/c1-11(12(2)20)16(24)19(6)8-7-18(5)15(23)10-13(21)9-14(22)17(3)4/h11H,7-10H2,1-6H3 |
| InChIKey | XOXIKNAPOGEAAR-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|