C12H21N3O6 — CID 134420966
methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[[(E)-2-nitroprop-1-enyl]amino]propanoate (PubChem CID 134420966) has the molecular formula C12H21N3O6 and a molecular weight of 303.32 g/mol. Its IUPAC name is methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[[(E)-2-nitroprop-1-enyl]amino]propanoate.
| Compound Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[[(E)-2-nitroprop-1-enyl]amino]propanoate |
|---|---|
| PubChem CID | 134420966 |
| Molecular Formula | C12H21N3O6 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[[(E)-2-nitroprop-1-enyl]amino]propanoate |
| SMILES | COC(=O)C(CN/C=C(\C)[N+](=O)[O-])NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H21N3O6/c1-8(15(18)19)6-13-7-9(10(16)20-5)14-11(17)21-12(2,3)4/h6,9,13H,7H2,1-5H3,(H,14,17)/b8-6+ |
| InChIKey | HOGWNUMRCLMNKC-SOFGYWHQSA-N |
| XLogP | 0.78 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|