C20H22N6OS — CID 134422564
2-[(6-cyano-1,3-benzothiazol-2-yl)amino]-N-[5-(methylamino)pentan-2-yl]pyridine-4-carboxamide (PubChem CID 134422564) has the molecular formula C20H22N6OS and a molecular weight of 394.50 g/mol. Its IUPAC name is 2-[(6-cyano-1,3-benzothiazol-2-yl)amino]-N-[5-(methylamino)pentan-2-yl]pyridine-4-carboxamide.
| Compound Name | 2-[(6-cyano-1,3-benzothiazol-2-yl)amino]-N-[5-(methylamino)pentan-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 134422564 |
| Molecular Formula | C20H22N6OS |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 2-[(6-cyano-1,3-benzothiazol-2-yl)amino]-N-[5-(methylamino)pentan-2-yl]pyridine-4-carboxamide |
| SMILES | CNCCCC(C)NC(=O)c1ccnc(Nc2nc3ccc(C#N)cc3s2)c1 |
| InChI | InChI=1S/C20H22N6OS/c1-13(4-3-8-22-2)24-19(27)15-7-9-23-18(11-15)26-20-25-16-6-5-14(12-21)10-17(16)28-20/h5-7,9-11,13,22H,3-4,8H2,1-2H3,(H,24,27)(H,23,25,26) |
| InChIKey | IBOTUICEDQPCDX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|