C17H21ClN4OS — CID 146255119
1-(4-chloro-6-methylheptan-2-yl)-3-(6-cyano-1,3-benzothiazol-2-yl)urea (PubChem CID 146255119) has the molecular formula C17H21ClN4OS and a molecular weight of 364.90 g/mol. Its IUPAC name is 1-(4-chloro-6-methylheptan-2-yl)-3-(6-cyano-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-(4-chloro-6-methylheptan-2-yl)-3-(6-cyano-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 146255119 |
| Molecular Formula | C17H21ClN4OS |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 1-(4-chloro-6-methylheptan-2-yl)-3-(6-cyano-1,3-benzothiazol-2-yl)urea |
| SMILES | CC(C)CC(Cl)CC(C)NC(=O)Nc1nc2ccc(C#N)cc2s1 |
| InChI | InChI=1S/C17H21ClN4OS/c1-10(2)6-13(18)7-11(3)20-16(23)22-17-21-14-5-4-12(9-19)8-15(14)24-17/h4-5,8,10-11,13H,6-7H2,1-3H3,(H2,20,21,22,23) |
| InChIKey | VPNAEKUSCRHLAE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|