About 1-(4-chloro-6-methylheptan-2-yl)-3-(6-cyano-1,3-benzothiazol-2-yl)urea
1-(4-chloro-6-methylheptan-2-yl)-3-(6-cyano-1,3-benzothiazol-2-yl)urea (PubChem CID 146255119) has the molecular formula C17H21ClN4OS
and a molecular weight of 364.90 g/mol. Its IUPAC name is 1-(4-chloro-6-methylheptan-2-yl)-3-(6-cyano-1,3-benzothiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-(4-chloro-6-methylheptan-2-yl)-3-(6-cyano-1,3-benzothiazol-2-yl)urea |
| PubChem CID | 146255119 |
| Molecular Formula | C17H21ClN4OS |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 1-(4-chloro-6-methylheptan-2-yl)-3-(6-cyano-1,3-benzothiazol-2-yl)urea |
| SMILES | CC(C)CC(Cl)CC(C)NC(=O)Nc1nc2ccc(C#N)cc2s1 |
| InChI | InChI=1S/C17H21ClN4OS/c1-10(2)6-13(18)7-11(3)20-16(23)22-17-21-14-5-4-12(9-19)8-15(14)24-17/h4-5,8,10-11,13H,6-7H2,1-3H3,(H2,20,21,22,23) |
| InChIKey | VPNAEKUSCRHLAE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-chloro-6-methylheptan-2-yl)-3-(6-cyano-1,3-benzothiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-6-methylheptan-2-yl)-3-(6-cyano-1,3-benzothiazol-2-yl)urea?
The IUPAC name of 1-(4-chloro-6-methylheptan-2-yl)-3-(6-cyano-1,3-benzothiazol-2-yl)urea (CID 146255119) is 1-(4-chloro-6-methylheptan-2-yl)-3-(6-cyano-1,3-benzothiazol-2-yl)urea.
What is the SMILES notation for 1-(4-chloro-6-methylheptan-2-yl)-3-(6-cyano-1,3-benzothiazol-2-yl)urea?
The canonical SMILES for 1-(4-chloro-6-methylheptan-2-yl)-3-(6-cyano-1,3-benzothiazol-2-yl)urea is CC(C)CC(Cl)CC(C)NC(=O)Nc1nc2ccc(C#N)cc2s1.
What is the InChIKey of 1-(4-chloro-6-methylheptan-2-yl)-3-(6-cyano-1,3-benzothiazol-2-yl)urea?
The InChIKey is VPNAEKUSCRHLAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21ClN4OS/c1-10(2)6-13(18)7-11(3)20-16(23)22-17-21-14-5-4-12(9-19)8-15(14)24-17/h4-5,8,10-11,13H,6-7H2,1-3H3,(H2,20,21,22,23).
What are the key properties of 1-(4-chloro-6-methylheptan-2-yl)-3-(6-cyano-1,3-benzothiazol-2-yl)urea?
1-(4-chloro-6-methylheptan-2-yl)-3-(6-cyano-1,3-benzothiazol-2-yl)urea has a molecular weight of 364.90 g/mol, XLogP of 4.72, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-6-methylheptan-2-yl)-3-(6-cyano-1,3-benzothiazol-2-yl)urea is sourced from PubChem (CID 146255119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).